C12H15N3S2 — CID 43368991
3-(1,3-benzothiazol-2-ylsulfanyl)pentanimidamide (PubChem CID 43368991) has the molecular formula C12H15N3S2 and a molecular weight of 265.41 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanyl)pentanimidamide.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanyl)pentanimidamide |
|---|---|
| PubChem CID | 43368991 |
| Molecular Formula | C12H15N3S2 |
| Molecular Weight | 265.41 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanyl)pentanimidamide |
| SMILES | [H]/N=C(\N)CC(CC)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H15N3S2/c1-2-8(7-11(13)14)16-12-15-9-5-3-4-6-10(9)17-12/h3-6,8H,2,7H2,1H3,(H3,13,14) |
| InChIKey | XIUAKOYSAPWNIB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|