C19H14F13NS4 — CID 25179061
2-[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)but-3-en-2-yldisulfanyl]-1,3-benzothiazole (PubChem CID 25179061) has the molecular formula C19H14F13NS4 and a molecular weight of 631.57 g/mol. Its IUPAC name is 2-[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)but-3-en-2-yldisulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)but-3-en-2-yldisulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 25179061 |
| Molecular Formula | C19H14F13NS4 |
| Molecular Weight | 631.57 g/mol |
| Exact Mass | 630.98 |
| IUPAC Name | 2-[1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)but-3-en-2-yldisulfanyl]-1,3-benzothiazole |
| SMILES | C=CC(CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H14F13NS4/c1-2-10(36-37-13-33-11-5-3-4-6-12(11)35-13)9-34-8-7-14(20,21)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32/h2-6,10H,1,7-9H2 |
| InChIKey | OYHOBAFENFQBGS-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.57 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|