C18H21NO4S2 — CID 67932984
2-(1,3-benzothiazol-2-ylsulfanyl)-3-(2,4-dimethylpentan-3-yl)but-2-enedioic acid (PubChem CID 67932984) has the molecular formula C18H21NO4S2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(2,4-dimethylpentan-3-yl)but-2-enedioic acid.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(2,4-dimethylpentan-3-yl)but-2-enedioic acid |
|---|---|
| PubChem CID | 67932984 |
| Molecular Formula | C18H21NO4S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(2,4-dimethylpentan-3-yl)but-2-enedioic acid |
| SMILES | CC(C)C(C(C(=O)O)=C(Sc1nc2ccccc2s1)C(=O)O)C(C)C |
| InChI | InChI=1S/C18H21NO4S2/c1-9(2)13(10(3)4)14(16(20)21)15(17(22)23)25-18-19-11-7-5-6-8-12(11)24-18/h5-10,13H,1-4H3,(H,20,21)(H,22,23) |
| InChIKey | OXMYJBNCKXPBET-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|