C16H14ClN3OS2 — CID 39995846
3-(1,3-benzothiazol-2-ylsulfanyl)-N'-(3-chlorophenyl)propanehydrazide (PubChem CID 39995846) has the molecular formula C16H14ClN3OS2 and a molecular weight of 363.90 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanyl)-N'-(3-chlorophenyl)propanehydrazide.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-N'-(3-chlorophenyl)propanehydrazide |
|---|---|
| PubChem CID | 39995846 |
| Molecular Formula | C16H14ClN3OS2 |
| Molecular Weight | 363.90 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-N'-(3-chlorophenyl)propanehydrazide |
| SMILES | O=C(CCSc1nc2ccccc2s1)NNc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14ClN3OS2/c17-11-4-3-5-12(10-11)19-20-15(21)8-9-22-16-18-13-6-1-2-7-14(13)23-16/h1-7,10,19H,8-9H2,(H,20,21) |
| InChIKey | OJGRMRIUBPGMHI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.90 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|