C16H13Cl2N3O2S — CID 39966204
2-(1,3-benzothiazol-2-ylmethoxy)-N'-(3,4-dichlorophenyl)acetohydrazide (PubChem CID 39966204) has the molecular formula C16H13Cl2N3O2S and a molecular weight of 382.27 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethoxy)-N'-(3,4-dichlorophenyl)acetohydrazide.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethoxy)-N'-(3,4-dichlorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 39966204 |
| Molecular Formula | C16H13Cl2N3O2S |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethoxy)-N'-(3,4-dichlorophenyl)acetohydrazide |
| SMILES | O=C(COCc1nc2ccccc2s1)NNc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2N3O2S/c17-11-6-5-10(7-12(11)18)20-21-15(22)8-23-9-16-19-13-3-1-2-4-14(13)24-16/h1-7,20H,8-9H2,(H,21,22) |
| InChIKey | JQOPXKNMVMQILI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|