C18H16ClN3O4S — CID 9278562
N'-[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]-5-chloro-2-methoxybenzohydrazide (PubChem CID 9278562) has the molecular formula C18H16ClN3O4S and a molecular weight of 405.86 g/mol. Its IUPAC name is N'-[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]-5-chloro-2-methoxybenzohydrazide.
| Compound Name | N'-[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]-5-chloro-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 9278562 |
| Molecular Formula | C18H16ClN3O4S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N'-[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]-5-chloro-2-methoxybenzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)COCc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H16ClN3O4S/c1-25-14-7-6-11(19)8-12(14)18(24)22-21-16(23)9-26-10-17-20-13-4-2-3-5-15(13)27-17/h2-8H,9-10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | KRRCVXOWAGZOSO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|