C23H27NO3S2 — CID 91330653
1-[4-[4-(1,3-benzothiazol-2-ylsulfanyl)butoxy]-2-hydroxy-3-methylphenyl]-3-methylbutan-2-one (PubChem CID 91330653) has the molecular formula C23H27NO3S2 and a molecular weight of 429.61 g/mol. Its IUPAC name is 1-[4-[4-(1,3-benzothiazol-2-ylsulfanyl)butoxy]-2-hydroxy-3-methylphenyl]-3-methylbutan-2-one.
| Compound Name | 1-[4-[4-(1,3-benzothiazol-2-ylsulfanyl)butoxy]-2-hydroxy-3-methylphenyl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 91330653 |
| Molecular Formula | C23H27NO3S2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 1-[4-[4-(1,3-benzothiazol-2-ylsulfanyl)butoxy]-2-hydroxy-3-methylphenyl]-3-methylbutan-2-one |
| SMILES | Cc1c(OCCCCSc2nc3ccccc3s2)ccc(CC(=O)C(C)C)c1O |
| InChI | InChI=1S/C23H27NO3S2/c1-15(2)19(25)14-17-10-11-20(16(3)22(17)26)27-12-6-7-13-28-23-24-18-8-4-5-9-21(18)29-23/h4-5,8-11,15,26H,6-7,12-14H2,1-3H3 |
| InChIKey | RGGLWYIOWSEILM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|