C19H20N2S2 — CID 18937869
N-(1,3-benzothiazol-2-ylsulfanyl)-2-(4-prop-1-en-2-ylphenyl)propan-2-amine (PubChem CID 18937869) has the molecular formula C19H20N2S2 and a molecular weight of 340.52 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylsulfanyl)-2-(4-prop-1-en-2-ylphenyl)propan-2-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylsulfanyl)-2-(4-prop-1-en-2-ylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 18937869 |
| Molecular Formula | C19H20N2S2 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylsulfanyl)-2-(4-prop-1-en-2-ylphenyl)propan-2-amine |
| SMILES | C=C(C)c1ccc(C(C)(C)NSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H20N2S2/c1-13(2)14-9-11-15(12-10-14)19(3,4)21-23-18-20-16-7-5-6-8-17(16)22-18/h5-12,21H,1H2,2-4H3 |
| InChIKey | PZDSMGRXZYJJDD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|