C13H18N2S3 — CID 88655947
N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine;sulfane (PubChem CID 88655947) has the molecular formula C13H18N2S3 and a molecular weight of 298.50 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine;sulfane.
| Compound Name | N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine;sulfane |
|---|---|
| PubChem CID | 88655947 |
| Molecular Formula | C13H18N2S3 |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine;sulfane |
| SMILES | S.c1ccc2sc(SNC3CCCCC3)nc2c1 |
| InChI | InChI=1S/C13H16N2S2.H2S/c1-2-6-10(7-3-1)15-17-13-14-11-8-4-5-9-12(11)16-13;/h4-5,8-10,15H,1-3,6-7H2;1H2 |
| InChIKey | YADJYPCJAPYLLT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|