C26H29N5S2 — CID 159128768
N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine;1,1-diphenylguanidine (PubChem CID 159128768) has the molecular formula C26H29N5S2 and a molecular weight of 475.69 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine;1,1-diphenylguanidine.
| Compound Name | N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine;1,1-diphenylguanidine |
|---|---|
| PubChem CID | 159128768 |
| Molecular Formula | C26H29N5S2 |
| Molecular Weight | 475.69 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine;1,1-diphenylguanidine |
| SMILES | [H]/N=C(\N)N(c1ccccc1)c1ccccc1.c1ccc2sc(SNC3CCCCC3)nc2c1 |
| InChI | InChI=1S/C13H13N3.C13H16N2S2/c14-13(15)16(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-6-10(7-3-1)15-17-13-14-11-8-4-5-9-12(11)16-13/h1-10H,(H3,14,15);4-5,8-10,15H,1-3,6-7H2 |
| InChIKey | KGPPKHDDLXBEEL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.69 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|