C19H22N2OS3 — CID 88802401
N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine;7-thiabicyclo[4.1.0]hepta-2,4-dien-1-ol (PubChem CID 88802401) has the molecular formula C19H22N2OS3 and a molecular weight of 390.60 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine;7-thiabicyclo[4.1.0]hepta-2,4-dien-1-ol.
| Compound Name | N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine;7-thiabicyclo[4.1.0]hepta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 88802401 |
| Molecular Formula | C19H22N2OS3 |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine;7-thiabicyclo[4.1.0]hepta-2,4-dien-1-ol |
| SMILES | OC12C=CC=CC1S2.c1ccc2sc(SNC3CCCCC3)nc2c1 |
| InChI | InChI=1S/C13H16N2S2.C6H6OS/c1-2-6-10(7-3-1)15-17-13-14-11-8-4-5-9-12(11)16-13;7-6-4-2-1-3-5(6)8-6/h4-5,8-10,15H,1-3,6-7H2;1-5,7H |
| InChIKey | OLILWAAAKHELTE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|