C11H11NO2S2 — CID 126847658
(3R,4R)-4-(1,3-benzothiazol-2-ylsulfanyl)oxolan-3-ol (PubChem CID 126847658) has the molecular formula C11H11NO2S2 and a molecular weight of 253.35 g/mol. Its IUPAC name is (3R,4R)-4-(1,3-benzothiazol-2-ylsulfanyl)oxolan-3-ol.
| Compound Name | (3R,4R)-4-(1,3-benzothiazol-2-ylsulfanyl)oxolan-3-ol |
|---|---|
| PubChem CID | 126847658 |
| Molecular Formula | C11H11NO2S2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | (3R,4R)-4-(1,3-benzothiazol-2-ylsulfanyl)oxolan-3-ol |
| SMILES | O[C@@H]1COC[C@H]1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H11NO2S2/c13-8-5-14-6-10(8)16-11-12-7-3-1-2-4-9(7)15-11/h1-4,8,10,13H,5-6H2/t8-,10-/m1/s1 |
| InChIKey | HRSCHIVFKQAGMK-PSASIEDQSA-N |
| XLogP | 2.15 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |