C12H15ClN2S2 — CID 18538492
2-piperidin-4-ylsulfanyl-1,3-benzothiazole;hydrochloride (PubChem CID 18538492) has the molecular formula C12H15ClN2S2 and a molecular weight of 286.85 g/mol. Its IUPAC name is 2-piperidin-4-ylsulfanyl-1,3-benzothiazole;hydrochloride.
| Compound Name | 2-piperidin-4-ylsulfanyl-1,3-benzothiazole;hydrochloride |
|---|---|
| PubChem CID | 18538492 |
| Molecular Formula | C12H15ClN2S2 |
| Molecular Weight | 286.85 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-piperidin-4-ylsulfanyl-1,3-benzothiazole;hydrochloride |
| SMILES | Cl.c1ccc2sc(SC3CCNCC3)nc2c1 |
| InChI | InChI=1S/C12H14N2S2.ClH/c1-2-4-11-10(3-1)14-12(16-11)15-9-5-7-13-8-6-9;/h1-4,9,13H,5-8H2;1H |
| InChIKey | QQZSWVKSVRYFDS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.85 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |