C11H9F2NS2 — CID 118868834
2-(3,3-difluorocyclobutyl)sulfanyl-1,3-benzothiazole (PubChem CID 118868834) has the molecular formula C11H9F2NS2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-(3,3-difluorocyclobutyl)sulfanyl-1,3-benzothiazole.
| Compound Name | 2-(3,3-difluorocyclobutyl)sulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 118868834 |
| Molecular Formula | C11H9F2NS2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 2-(3,3-difluorocyclobutyl)sulfanyl-1,3-benzothiazole |
| SMILES | FC1(F)CC(Sc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C11H9F2NS2/c12-11(13)5-7(6-11)15-10-14-8-3-1-2-4-9(8)16-10/h1-4,7H,5-6H2 |
| InChIKey | MDIGZWQFAZADFH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |