C12H12ClNS2 — CID 16762346
2-(2-chlorocyclopentyl)sulfanyl-1,3-benzothiazole (PubChem CID 16762346) has the molecular formula C12H12ClNS2 and a molecular weight of 269.82 g/mol. Its IUPAC name is 2-(2-chlorocyclopentyl)sulfanyl-1,3-benzothiazole.
| Compound Name | 2-(2-chlorocyclopentyl)sulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 16762346 |
| Molecular Formula | C12H12ClNS2 |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 2-(2-chlorocyclopentyl)sulfanyl-1,3-benzothiazole |
| SMILES | ClC1CCCC1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H12ClNS2/c13-8-4-3-7-10(8)15-12-14-9-5-1-2-6-11(9)16-12/h1-2,5-6,8,10H,3-4,7H2 |
| InChIKey | BOQAXXHHDXHWCG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|