C13H16N2S3 — CID 158162347
N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylthiohydroxylamine (PubChem CID 158162347) has the molecular formula C13H16N2S3 and a molecular weight of 296.49 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylthiohydroxylamine.
| Compound Name | N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylthiohydroxylamine |
|---|---|
| PubChem CID | 158162347 |
| Molecular Formula | C13H16N2S3 |
| Molecular Weight | 296.49 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylsulfanyl)-N-cyclohexylthiohydroxylamine |
| SMILES | SN(Sc1nc2ccccc2s1)C1CCCCC1 |
| InChI | InChI=1S/C13H16N2S3/c16-15(10-6-2-1-3-7-10)18-13-14-11-8-4-5-9-12(11)17-13/h4-5,8-10,16H,1-3,6-7H2 |
| InChIKey | FWKQVFMJPJHKKY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 16.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|