C15H19BrN2S — CID 80675483
N-(2-bromoethyl)-N-cyclohexyl-1,3-benzothiazol-2-amine (PubChem CID 80675483) has the molecular formula C15H19BrN2S and a molecular weight of 339.30 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-cyclohexyl-1,3-benzothiazol-2-amine.
| Compound Name | N-(2-bromoethyl)-N-cyclohexyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 80675483 |
| Molecular Formula | C15H19BrN2S |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N-(2-bromoethyl)-N-cyclohexyl-1,3-benzothiazol-2-amine |
| SMILES | BrCCN(c1nc2ccccc2s1)C1CCCCC1 |
| InChI | InChI=1S/C15H19BrN2S/c16-10-11-18(12-6-2-1-3-7-12)15-17-13-8-4-5-9-14(13)19-15/h4-5,8-9,12H,1-3,6-7,10-11H2 |
| InChIKey | BJBVYAKOHOIKQX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|