C18H27N3S — CID 174554067
N-hexyl-N-piperidin-2-yl-1,3-benzothiazol-2-amine (PubChem CID 174554067) has the molecular formula C18H27N3S and a molecular weight of 317.50 g/mol. Its IUPAC name is N-hexyl-N-piperidin-2-yl-1,3-benzothiazol-2-amine.
| Compound Name | N-hexyl-N-piperidin-2-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 174554067 |
| Molecular Formula | C18H27N3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N-hexyl-N-piperidin-2-yl-1,3-benzothiazol-2-amine |
| SMILES | CCCCCCN(c1nc2ccccc2s1)C1CCCCN1 |
| InChI | InChI=1S/C18H27N3S/c1-2-3-4-9-14-21(17-12-7-8-13-19-17)18-20-15-10-5-6-11-16(15)22-18/h5-6,10-11,17,19H,2-4,7-9,12-14H2,1H3 |
| InChIKey | JGHAFBCGJQHSPW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|