C33H43N5OS4 — CID 139920012
N-[1,7-bis[1,3-benzothiazol-2-ylsulfanyl(cyclohexyl)amino]heptan-4-ylidene]hydroxylamine (PubChem CID 139920012) has the molecular formula C33H43N5OS4 and a molecular weight of 654.01 g/mol. Its IUPAC name is N-[1,7-bis[1,3-benzothiazol-2-ylsulfanyl(cyclohexyl)amino]heptan-4-ylidene]hydroxylamine.
| Compound Name | N-[1,7-bis[1,3-benzothiazol-2-ylsulfanyl(cyclohexyl)amino]heptan-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 139920012 |
| Molecular Formula | C33H43N5OS4 |
| Molecular Weight | 654.01 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | N-[1,7-bis[1,3-benzothiazol-2-ylsulfanyl(cyclohexyl)amino]heptan-4-ylidene]hydroxylamine |
| SMILES | ON=C(CCCN(Sc1nc2ccccc2s1)C1CCCCC1)CCCN(Sc1nc2ccccc2s1)C1CCCCC1 |
| InChI | InChI=1S/C33H43N5OS4/c39-36-25(13-11-23-37(26-15-3-1-4-16-26)42-32-34-28-19-7-9-21-30(28)40-32)14-12-24-38(27-17-5-2-6-18-27)43-33-35-29-20-8-10-22-31(29)41-33/h7-10,19-22,26-27,39H,1-6,11-18,23-24H2 |
| InChIKey | JSGVFUQDLXJWMP-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.01 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|