C15H16N2OS2 — CID 98157282
(NE)-N-[(8S)-8-(1,3-benzothiazol-2-ylsulfanyl)cyclooct-4-en-1-ylidene]hydroxylamine (PubChem CID 98157282) has the molecular formula C15H16N2OS2 and a molecular weight of 304.44 g/mol. Its IUPAC name is (NE)-N-[(8S)-8-(1,3-benzothiazol-2-ylsulfanyl)cyclooct-4-en-1-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(8S)-8-(1,3-benzothiazol-2-ylsulfanyl)cyclooct-4-en-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 98157282 |
| Molecular Formula | C15H16N2OS2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (NE)-N-[(8S)-8-(1,3-benzothiazol-2-ylsulfanyl)cyclooct-4-en-1-ylidene]hydroxylamine |
| SMILES | O/N=C1\CCC=CCC[C@@H]1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H16N2OS2/c18-17-12-8-3-1-2-4-9-14(12)20-15-16-11-7-5-6-10-13(11)19-15/h1-2,5-7,10,14,18H,3-4,8-9H2/b2-1?,17-12+/t14-/m0/s1 |
| InChIKey | FCWNNTCTCGAHLD-VVRGUVHJSA-N |
| XLogP | 4.72 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|