C26H37NS2 — CID 100937569
2-[[(1R,3aR,4S,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]sulfanyl]-1,3-benzothiazole (PubChem CID 100937569) has the molecular formula C26H37NS2 and a molecular weight of 427.72 g/mol. Its IUPAC name is 2-[[(1R,3aR,4S,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]sulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[[(1R,3aR,4S,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]sulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 100937569 |
| Molecular Formula | C26H37NS2 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 2-[[(1R,3aR,4S,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]sulfanyl]-1,3-benzothiazole |
| SMILES | CC(C)[C@@H](C)/C=C/[C@@H](C)[C@H]1CC[C@H]2[C@@H](Sc3nc4ccccc4s3)CCC[C@]12C |
| InChI | InChI=1S/C26H37NS2/c1-17(2)18(3)12-13-19(4)20-14-15-21-23(11-8-16-26(20,21)5)28-25-27-22-9-6-7-10-24(22)29-25/h6-7,9-10,12-13,17-21,23H,8,11,14-16H2,1-5H3/b13-12+/t18-,19+,20+,21-,23-,26+/m0/s1 |
| InChIKey | FILCJMOJUCKWOI-AOMRYEQWSA-N |
| XLogP | 8.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|