C29H39NOPS3- — CID 166501014
CID 166501014 (PubChem CID 166501014) has the molecular formula C29H39NOPS3- and a molecular weight of 544.81 g/mol.
| Compound Name | CID 166501014 |
|---|---|
| PubChem CID | 166501014 |
| Molecular Formula | C29H39NOPS3- |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | — |
| SMILES | C[C@H](CSc1nc2ccccc2s1)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O[SH-]#P)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H39NOPS3/c1-18(17-33-27-30-25-6-4-5-7-26(25)34-27)22-10-11-23-21-9-8-19-16-20(31-35-32)12-14-28(19,2)24(21)13-15-29(22,23)3/h4-8,18,20-24,35H,9-17H2,1-3H3/q-1/t18-,20+,21+,22-,23+,24+,28+,29-/m1/s1 |
| InChIKey | KCVIOALWBSOCHP-CAXKEKIMSA-N |
| XLogP | 9.04 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|