C14H18N2S3 — CID 21441506
N-(1,3-benzothiazol-2-yldisulfanyl)-1-methylcyclohexan-1-amine (PubChem CID 21441506) has the molecular formula C14H18N2S3 and a molecular weight of 310.51 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yldisulfanyl)-1-methylcyclohexan-1-amine.
| Compound Name | N-(1,3-benzothiazol-2-yldisulfanyl)-1-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 21441506 |
| Molecular Formula | C14H18N2S3 |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-(1,3-benzothiazol-2-yldisulfanyl)-1-methylcyclohexan-1-amine |
| SMILES | CC1(NSSc2nc3ccccc3s2)CCCCC1 |
| InChI | InChI=1S/C14H18N2S3/c1-14(9-5-2-6-10-14)16-19-18-13-15-11-7-3-4-8-12(11)17-13/h3-4,7-8,16H,2,5-6,9-10H2,1H3 |
| InChIKey | OGMUCABOGTXXPR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|