C19H23N3O3S4 — CID 175412087
2-aminobenzenesulfonic acid;N-(1,3-benzothiazol-2-yldisulfanyl)cyclohexanamine (PubChem CID 175412087) has the molecular formula C19H23N3O3S4 and a molecular weight of 469.68 g/mol. Its IUPAC name is 2-aminobenzenesulfonic acid;N-(1,3-benzothiazol-2-yldisulfanyl)cyclohexanamine.
| Compound Name | 2-aminobenzenesulfonic acid;N-(1,3-benzothiazol-2-yldisulfanyl)cyclohexanamine |
|---|---|
| PubChem CID | 175412087 |
| Molecular Formula | C19H23N3O3S4 |
| Molecular Weight | 469.68 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 2-aminobenzenesulfonic acid;N-(1,3-benzothiazol-2-yldisulfanyl)cyclohexanamine |
| SMILES | Nc1ccccc1S(=O)(=O)O.c1ccc2sc(SSNC3CCCCC3)nc2c1 |
| InChI | InChI=1S/C13H16N2S3.C6H7NO3S/c1-2-6-10(7-3-1)15-18-17-13-14-11-8-4-5-9-12(11)16-13;7-5-3-1-2-4-6(5)11(8,9)10/h4-5,8-10,15H,1-3,6-7H2;1-4H,7H2,(H,8,9,10) |
| InChIKey | IHIFCJLKVGYZSR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.68 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|