C13H10N6S2 — CID 58893108
8-(1,3-benzothiazol-2-ylsulfanyl)-2-methyl-7H-purin-6-amine (PubChem CID 58893108) has the molecular formula C13H10N6S2 and a molecular weight of 314.40 g/mol. Its IUPAC name is 8-(1,3-benzothiazol-2-ylsulfanyl)-2-methyl-7H-purin-6-amine.
| Compound Name | 8-(1,3-benzothiazol-2-ylsulfanyl)-2-methyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 58893108 |
| Molecular Formula | C13H10N6S2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 8-(1,3-benzothiazol-2-ylsulfanyl)-2-methyl-7H-purin-6-amine |
| SMILES | Cc1nc(N)c2[nH]c(Sc3nc4ccccc4s3)nc2n1 |
| InChI | InChI=1S/C13H10N6S2/c1-6-15-10(14)9-11(16-6)19-12(18-9)21-13-17-7-4-2-3-5-8(7)20-13/h2-5H,1H3,(H3,14,15,16,18,19) |
| InChIKey | JUJVEWPRKHCBIL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |