C12H7BrN6S2 — CID 141197482
8-[(7-bromo-1,3-benzothiazol-2-yl)sulfanyl]-7H-purin-6-amine (PubChem CID 141197482) has the molecular formula C12H7BrN6S2 and a molecular weight of 379.27 g/mol. Its IUPAC name is 8-[(7-bromo-1,3-benzothiazol-2-yl)sulfanyl]-7H-purin-6-amine.
| Compound Name | 8-[(7-bromo-1,3-benzothiazol-2-yl)sulfanyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 141197482 |
| Molecular Formula | C12H7BrN6S2 |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 377.94 |
| IUPAC Name | 8-[(7-bromo-1,3-benzothiazol-2-yl)sulfanyl]-7H-purin-6-amine |
| SMILES | Nc1ncnc2nc(Sc3nc4cccc(Br)c4s3)[nH]c12 |
| InChI | InChI=1S/C12H7BrN6S2/c13-5-2-1-3-6-8(5)20-12(17-6)21-11-18-7-9(14)15-4-16-10(7)19-11/h1-4H,(H3,14,15,16,18,19) |
| InChIKey | WARJMBMOPWQUPY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |