C15H9ClN2O4S2 — CID 67256899
methyl 2-(2-chloro-4-nitrophenyl)sulfanyl-1,3-benzothiazole-5-carboxylate (PubChem CID 67256899) has the molecular formula C15H9ClN2O4S2 and a molecular weight of 380.83 g/mol. Its IUPAC name is methyl 2-(2-chloro-4-nitrophenyl)sulfanyl-1,3-benzothiazole-5-carboxylate.
| Compound Name | methyl 2-(2-chloro-4-nitrophenyl)sulfanyl-1,3-benzothiazole-5-carboxylate |
|---|---|
| PubChem CID | 67256899 |
| Molecular Formula | C15H9ClN2O4S2 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | methyl 2-(2-chloro-4-nitrophenyl)sulfanyl-1,3-benzothiazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2sc(Sc3ccc([N+](=O)[O-])cc3Cl)nc2c1 |
| InChI | InChI=1S/C15H9ClN2O4S2/c1-22-14(19)8-2-4-13-11(6-8)17-15(24-13)23-12-5-3-9(18(20)21)7-10(12)16/h2-7H,1H3 |
| InChIKey | ILZYUHGNUBQLJV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|