C24H20N4O6S2 — CID 98095532
N-[(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)-5-nitrophenyl]methylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 98095532) has the molecular formula C24H20N4O6S2 and a molecular weight of 524.58 g/mol. Its IUPAC name is N-[(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)-5-nitrophenyl]methylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)-5-nitrophenyl]methylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 98095532 |
| Molecular Formula | C24H20N4O6S2 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | N-[(Z)-[2-(1,3-benzothiazol-2-ylsulfanyl)-5-nitrophenyl]methylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C\c2cc([N+](=O)[O-])ccc2Sc2nc3ccccc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C24H20N4O6S2/c1-32-18-11-14(12-19(33-2)22(18)34-3)23(29)27-25-13-15-10-16(28(30)31)8-9-20(15)35-24-26-17-6-4-5-7-21(17)36-24/h4-13H,1-3H3,(H,27,29)/b25-13- |
| InChIKey | FDTVGBLLRNVSOO-MXAYSNPKSA-N |
| XLogP | 5.15 |
| TPSA | 125.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|