C19H16ClNO6S — CID 168569728
2-(4-chlorophenyl)sulfanyl-5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzoic acid (PubChem CID 168569728) has the molecular formula C19H16ClNO6S and a molecular weight of 421.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzoic acid.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 168569728 |
| Molecular Formula | C19H16ClNO6S |
| Molecular Weight | 421.86 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-5-[[(E)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]amino]benzoic acid |
| SMILES | COC(=O)/C=C(/Nc1ccc(Sc2ccc(Cl)cc2)c(C(=O)O)c1)C(=O)OC |
| InChI | InChI=1S/C19H16ClNO6S/c1-26-17(22)10-15(19(25)27-2)21-12-5-8-16(14(9-12)18(23)24)28-13-6-3-11(20)4-7-13/h3-10,21H,1-2H3,(H,23,24)/b15-10+ |
| InChIKey | KRKLZTFQFZQRDK-XNTDXEJSSA-N |
| XLogP | 3.83 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.86 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|