C15H17N3O5 — CID 168567594
dimethyl (E)-2-[[2-(2-hydroxyethyl)indazol-5-yl]amino]but-2-enedioate (PubChem CID 168567594) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is dimethyl (E)-2-[[2-(2-hydroxyethyl)indazol-5-yl]amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[[2-(2-hydroxyethyl)indazol-5-yl]amino]but-2-enedioate |
|---|---|
| PubChem CID | 168567594 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | dimethyl (E)-2-[[2-(2-hydroxyethyl)indazol-5-yl]amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc2nn(CCO)cc2c1)C(=O)OC |
| InChI | InChI=1S/C15H17N3O5/c1-22-14(20)8-13(15(21)23-2)16-11-3-4-12-10(7-11)9-18(17-12)5-6-19/h3-4,7-9,16,19H,5-6H2,1-2H3/b13-8+ |
| InChIKey | NPLDGYNAYFWDAR-MDWZMJQESA-N |
| XLogP | 0.67 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|