C17H21N3O4 — CID 168570679
dimethyl (E)-2-[(2-methyl-1-propylbenzimidazol-5-yl)amino]but-2-enedioate (PubChem CID 168570679) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is dimethyl (E)-2-[(2-methyl-1-propylbenzimidazol-5-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(2-methyl-1-propylbenzimidazol-5-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 168570679 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | dimethyl (E)-2-[(2-methyl-1-propylbenzimidazol-5-yl)amino]but-2-enedioate |
| SMILES | CCCn1c(C)nc2cc(N/C(=C/C(=O)OC)C(=O)OC)ccc21 |
| InChI | InChI=1S/C17H21N3O4/c1-5-8-20-11(2)18-13-9-12(6-7-15(13)20)19-14(17(22)24-4)10-16(21)23-3/h6-7,9-10,19H,5,8H2,1-4H3/b14-10+ |
| InChIKey | RECQGERNPXWSSM-GXDHUFHOSA-N |
| XLogP | 2.40 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|