C18H21N3O4 — CID 168537499
2,2-dimethyl-5-[[(2-methyl-1-propylbenzimidazol-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168537499) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[(2-methyl-1-propylbenzimidazol-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[(2-methyl-1-propylbenzimidazol-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168537499 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2,2-dimethyl-5-[[(2-methyl-1-propylbenzimidazol-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CCCn1c(C)nc2cc(NC=C3C(=O)OC(C)(C)OC3=O)ccc21 |
| InChI | InChI=1S/C18H21N3O4/c1-5-8-21-11(2)20-14-9-12(6-7-15(14)21)19-10-13-16(22)24-18(3,4)25-17(13)23/h6-7,9-10,19H,5,8H2,1-4H3 |
| InChIKey | LJJJYKKOHAHZQN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|