C17H16N2O7 — CID 2798723
dimethyl 2-[(3-acetamido-2-oxochromen-6-yl)amino]but-2-enedioate (PubChem CID 2798723) has the molecular formula C17H16N2O7 and a molecular weight of 360.32 g/mol. Its IUPAC name is dimethyl 2-[(3-acetamido-2-oxochromen-6-yl)amino]but-2-enedioate.
| Compound Name | dimethyl 2-[(3-acetamido-2-oxochromen-6-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 2798723 |
| Molecular Formula | C17H16N2O7 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | dimethyl 2-[(3-acetamido-2-oxochromen-6-yl)amino]but-2-enedioate |
| SMILES | COC(=O)C=C(Nc1ccc2oc(=O)c(NC(C)=O)cc2c1)C(=O)OC |
| InChI | InChI=1S/C17H16N2O7/c1-9(20)18-12-7-10-6-11(4-5-14(10)26-17(12)23)19-13(16(22)25-3)8-15(21)24-2/h4-8,19H,1-3H3,(H,18,20) |
| InChIKey | KZPAKTWYROXPLG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|