C22H22N2O8 — CID 62705146
2-(3-acetamido-6-methoxy-2-oxochromen-7-yl)oxy-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 62705146) has the molecular formula C22H22N2O8 and a molecular weight of 442.42 g/mol. Its IUPAC name is 2-(3-acetamido-6-methoxy-2-oxochromen-7-yl)oxy-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(3-acetamido-6-methoxy-2-oxochromen-7-yl)oxy-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 62705146 |
| Molecular Formula | C22H22N2O8 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-(3-acetamido-6-methoxy-2-oxochromen-7-yl)oxy-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2cc3oc(=O)c(NC(C)=O)cc3cc2OC)cc1OC |
| InChI | InChI=1S/C22H22N2O8/c1-12(25)23-15-7-13-8-18(29-3)20(10-17(13)32-22(15)27)31-11-21(26)24-14-5-6-16(28-2)19(9-14)30-4/h5-10H,11H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | FLROUTXCGQARMR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|