C19H21N3O8 — CID 162663123
N-[6-methoxy-7-[5-[(5-oxido-1,2,5-oxadiazol-5-ium-3-yl)oxy]pentoxy]-2-oxochromen-3-yl]acetamide (PubChem CID 162663123) has the molecular formula C19H21N3O8 and a molecular weight of 419.39 g/mol. Its IUPAC name is N-[6-methoxy-7-[5-[(5-oxido-1,2,5-oxadiazol-5-ium-3-yl)oxy]pentoxy]-2-oxochromen-3-yl]acetamide.
| Compound Name | N-[6-methoxy-7-[5-[(5-oxido-1,2,5-oxadiazol-5-ium-3-yl)oxy]pentoxy]-2-oxochromen-3-yl]acetamide |
|---|---|
| PubChem CID | 162663123 |
| Molecular Formula | C19H21N3O8 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[6-methoxy-7-[5-[(5-oxido-1,2,5-oxadiazol-5-ium-3-yl)oxy]pentoxy]-2-oxochromen-3-yl]acetamide |
| SMILES | COc1cc2cc(NC(C)=O)c(=O)oc2cc1OCCCCCOc1c[n+]([O-])on1 |
| InChI | InChI=1S/C19H21N3O8/c1-12(23)20-14-8-13-9-16(26-2)17(10-15(13)29-19(14)24)27-6-4-3-5-7-28-18-11-22(25)30-21-18/h8-11H,3-7H2,1-2H3,(H,20,23) |
| InChIKey | KUGLXAUOCJDDGS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 139.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|