C18H22O7S — CID 19927634
4-[(7-methoxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-8-yl)oxy]butyl methanesulfonate (PubChem CID 19927634) has the molecular formula C18H22O7S and a molecular weight of 382.43 g/mol. Its IUPAC name is 4-[(7-methoxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-8-yl)oxy]butyl methanesulfonate.
| Compound Name | 4-[(7-methoxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-8-yl)oxy]butyl methanesulfonate |
|---|---|
| PubChem CID | 19927634 |
| Molecular Formula | C18H22O7S |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-[(7-methoxy-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-8-yl)oxy]butyl methanesulfonate |
| SMILES | COc1cc2oc(=O)c3c(c2cc1OCCCCOS(C)(=O)=O)CCC3 |
| InChI | InChI=1S/C18H22O7S/c1-22-16-11-15-14(12-6-5-7-13(12)18(19)25-15)10-17(16)23-8-3-4-9-24-26(2,20)21/h10-11H,3-9H2,1-2H3 |
| InChIKey | PGHVSZFBTJNMEC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|