C20H19NO7 — CID 6227079
2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 6227079) has the molecular formula C20H19NO7 and a molecular weight of 385.37 g/mol. Its IUPAC name is 2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 6227079 |
| Molecular Formula | C20H19NO7 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-(5,7-dihydroxy-4-methyl-2-oxochromen-3-yl)-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cc2c(C)c3c(O)cc(O)cc3oc2=O)cc1OC |
| InChI | InChI=1S/C20H19NO7/c1-10-13(20(25)28-17-8-12(22)7-14(23)19(10)17)9-18(24)21-11-4-5-15(26-2)16(6-11)27-3/h4-8,22-23H,9H2,1-3H3,(H,21,24) |
| InChIKey | IVKCOGALRXLHRY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|