C18H19N3O6 — CID 168570535
dimethyl (E)-2-[3-(4,6-dimethoxypyrimidin-2-yl)anilino]but-2-enedioate (PubChem CID 168570535) has the molecular formula C18H19N3O6 and a molecular weight of 373.37 g/mol. Its IUPAC name is dimethyl (E)-2-[3-(4,6-dimethoxypyrimidin-2-yl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-(4,6-dimethoxypyrimidin-2-yl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168570535 |
| Molecular Formula | C18H19N3O6 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | dimethyl (E)-2-[3-(4,6-dimethoxypyrimidin-2-yl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cccc(-c2nc(OC)cc(OC)n2)c1)C(=O)OC |
| InChI | InChI=1S/C18H19N3O6/c1-24-14-10-15(25-2)21-17(20-14)11-6-5-7-12(8-11)19-13(18(23)27-4)9-16(22)26-3/h5-10,19H,1-4H3/b13-9+ |
| InChIKey | JNGHQQRATNFADJ-UKTHLTGXSA-N |
| XLogP | 1.80 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|