C16H18N4O4 — CID 168569780
dimethyl (E)-2-[3-(5-ethyl-1H-1,2,4-triazol-3-yl)anilino]but-2-enedioate (PubChem CID 168569780) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is dimethyl (E)-2-[3-(5-ethyl-1H-1,2,4-triazol-3-yl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-(5-ethyl-1H-1,2,4-triazol-3-yl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168569780 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | dimethyl (E)-2-[3-(5-ethyl-1H-1,2,4-triazol-3-yl)anilino]but-2-enedioate |
| SMILES | CCc1nc(-c2cccc(N/C(=C/C(=O)OC)C(=O)OC)c2)n[nH]1 |
| InChI | InChI=1S/C16H18N4O4/c1-4-13-18-15(20-19-13)10-6-5-7-11(8-10)17-12(16(22)24-3)9-14(21)23-2/h5-9,17H,4H2,1-3H3,(H,18,19,20)/b12-9+ |
| InChIKey | FUPBBMVJLWSUHA-FMIVXFBMSA-N |
| XLogP | 1.68 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|