C16H12N4OS — CID 168522916
N-[3-(6-amino-1,3-benzothiazol-2-yl)phenyl]-2-cyanoacetamide (PubChem CID 168522916) has the molecular formula C16H12N4OS and a molecular weight of 308.37 g/mol. Its IUPAC name is N-[3-(6-amino-1,3-benzothiazol-2-yl)phenyl]-2-cyanoacetamide.
| Compound Name | N-[3-(6-amino-1,3-benzothiazol-2-yl)phenyl]-2-cyanoacetamide |
|---|---|
| PubChem CID | 168522916 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | N-[3-(6-amino-1,3-benzothiazol-2-yl)phenyl]-2-cyanoacetamide |
| SMILES | N#CCC(=O)Nc1cccc(-c2nc3ccc(N)cc3s2)c1 |
| InChI | InChI=1S/C16H12N4OS/c17-7-6-15(21)19-12-3-1-2-10(8-12)16-20-13-5-4-11(18)9-14(13)22-16/h1-5,8-9H,6,18H2,(H,19,21) |
| InChIKey | BYMRFUUOIRWJBD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|