C20H15N5O2S — CID 168548857
methyl 3-amino-1-[3-(6-amino-1,3-benzothiazol-2-yl)phenyl]-4-cyanopyrrole-2-carboxylate (PubChem CID 168548857) has the molecular formula C20H15N5O2S and a molecular weight of 389.44 g/mol. Its IUPAC name is methyl 3-amino-1-[3-(6-amino-1,3-benzothiazol-2-yl)phenyl]-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-1-[3-(6-amino-1,3-benzothiazol-2-yl)phenyl]-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168548857 |
| Molecular Formula | C20H15N5O2S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | methyl 3-amino-1-[3-(6-amino-1,3-benzothiazol-2-yl)phenyl]-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cccc(-c2nc3ccc(N)cc3s2)c1 |
| InChI | InChI=1S/C20H15N5O2S/c1-27-20(26)18-17(23)12(9-21)10-25(18)14-4-2-3-11(7-14)19-24-15-6-5-13(22)8-16(15)28-19/h2-8,10H,22-23H2,1H3 |
| InChIKey | IKQYPPSGYKHXSU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|