C16H13N5O2 — CID 168546967
methyl 3-amino-4-cyano-1-[3-(1H-imidazol-5-yl)phenyl]pyrrole-2-carboxylate (PubChem CID 168546967) has the molecular formula C16H13N5O2 and a molecular weight of 307.31 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[3-(1H-imidazol-5-yl)phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[3-(1H-imidazol-5-yl)phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168546967 |
| Molecular Formula | C16H13N5O2 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[3-(1H-imidazol-5-yl)phenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cccc(-c2cnc[nH]2)c1 |
| InChI | InChI=1S/C16H13N5O2/c1-23-16(22)15-14(18)11(6-17)8-21(15)12-4-2-3-10(5-12)13-7-19-9-20-13/h2-5,7-9H,18H2,1H3,(H,19,20) |
| InChIKey | LXZKOGWEUCTDSW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |