C21H16N4O2 — CID 168548037
methyl 3-amino-4-cyano-1-[3-(1H-indol-2-yl)phenyl]pyrrole-2-carboxylate (PubChem CID 168548037) has the molecular formula C21H16N4O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[3-(1H-indol-2-yl)phenyl]pyrrole-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-1-[3-(1H-indol-2-yl)phenyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168548037 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[3-(1H-indol-2-yl)phenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cccc(-c2cc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C21H16N4O2/c1-27-21(26)20-19(23)15(11-22)12-25(20)16-7-4-6-13(9-16)18-10-14-5-2-3-8-17(14)24-18/h2-10,12,24H,23H2,1H3 |
| InChIKey | IJRFZTLQJSMICF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 96.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |