C12H12N2OS2 — CID 46738599
2-cyano-N-(2,3-dimethylphenyl)-3,3-bis(sulfanyl)prop-2-enamide (PubChem CID 46738599) has the molecular formula C12H12N2OS2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 2-cyano-N-(2,3-dimethylphenyl)-3,3-bis(sulfanyl)prop-2-enamide.
| Compound Name | 2-cyano-N-(2,3-dimethylphenyl)-3,3-bis(sulfanyl)prop-2-enamide |
|---|---|
| PubChem CID | 46738599 |
| Molecular Formula | C12H12N2OS2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-cyano-N-(2,3-dimethylphenyl)-3,3-bis(sulfanyl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)C(C#N)=C(S)S)c1C |
| InChI | InChI=1S/C12H12N2OS2/c1-7-4-3-5-10(8(7)2)14-11(15)9(6-13)12(16)17/h3-5,16-17H,1-2H3,(H,14,15) |
| InChIKey | FAHPHVDYBHUBJK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|