C17H23NO2S2 — CID 139226220
2-[bis(methylsulfanyl)methylidene]-N-(2,3-dimethylphenyl)-4-methyl-3-oxopentanamide (PubChem CID 139226220) has the molecular formula C17H23NO2S2 and a molecular weight of 337.51 g/mol. Its IUPAC name is 2-[bis(methylsulfanyl)methylidene]-N-(2,3-dimethylphenyl)-4-methyl-3-oxopentanamide.
| Compound Name | 2-[bis(methylsulfanyl)methylidene]-N-(2,3-dimethylphenyl)-4-methyl-3-oxopentanamide |
|---|---|
| PubChem CID | 139226220 |
| Molecular Formula | C17H23NO2S2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-[bis(methylsulfanyl)methylidene]-N-(2,3-dimethylphenyl)-4-methyl-3-oxopentanamide |
| SMILES | CSC(SC)=C(C(=O)Nc1cccc(C)c1C)C(=O)C(C)C |
| InChI | InChI=1S/C17H23NO2S2/c1-10(2)15(19)14(17(21-5)22-6)16(20)18-13-9-7-8-11(3)12(13)4/h7-10H,1-6H3,(H,18,20) |
| InChIKey | JDLHPXYBOAICAD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|