C21H18N4O4S — CID 166182205
1-(4-cyanophenyl)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]urea (PubChem CID 166182205) has the molecular formula C21H18N4O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 166182205 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]urea |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=O)Nc3ccc(C#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C21H18N4O4S/c1-29-19-10-6-18(7-11-19)25-30(27,28)20-12-8-17(9-13-20)24-21(26)23-16-4-2-15(14-22)3-5-16/h2-13,25H,1H3,(H2,23,24,26) |
| InChIKey | ZTNQJKDYULAKLO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |