C22H18Cl2N2O4S — CID 3548859
N-[2-chloro-5-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(3-methoxyphenyl)prop-2-enamide (PubChem CID 3548859) has the molecular formula C22H18Cl2N2O4S and a molecular weight of 477.37 g/mol. Its IUPAC name is N-[2-chloro-5-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[2-chloro-5-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3548859 |
| Molecular Formula | C22H18Cl2N2O4S |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | N-[2-chloro-5-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(C=CC(=O)Nc2cc(S(=O)(=O)Nc3ccc(Cl)cc3)ccc2Cl)c1 |
| InChI | InChI=1S/C22H18Cl2N2O4S/c1-30-18-4-2-3-15(13-18)5-12-22(27)25-21-14-19(10-11-20(21)24)31(28,29)26-17-8-6-16(23)7-9-17/h2-14,26H,1H3,(H,25,27) |
| InChIKey | CYVXGZUKSJXAJC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|