C19H13BrCl2N2O4S — CID 4291160
3-(5-bromofuran-2-yl)-N-[2-chloro-5-[(4-chlorophenyl)sulfamoyl]phenyl]prop-2-enamide (PubChem CID 4291160) has the molecular formula C19H13BrCl2N2O4S and a molecular weight of 516.20 g/mol. Its IUPAC name is 3-(5-bromofuran-2-yl)-N-[2-chloro-5-[(4-chlorophenyl)sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | 3-(5-bromofuran-2-yl)-N-[2-chloro-5-[(4-chlorophenyl)sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4291160 |
| Molecular Formula | C19H13BrCl2N2O4S |
| Molecular Weight | 516.20 g/mol |
| Exact Mass | 513.92 |
| IUPAC Name | 3-(5-bromofuran-2-yl)-N-[2-chloro-5-[(4-chlorophenyl)sulfamoyl]phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Br)o1)Nc1cc(S(=O)(=O)Nc2ccc(Cl)cc2)ccc1Cl |
| InChI | InChI=1S/C19H13BrCl2N2O4S/c20-18-9-5-14(28-18)6-10-19(25)23-17-11-15(7-8-16(17)22)29(26,27)24-13-3-1-12(21)2-4-13/h1-11,24H,(H,23,25) |
| InChIKey | QEFUHWGZELGJMJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.20 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|