C14H10BrF2NO4S — CID 47093671
3-(5-bromofuran-2-yl)-N-[4-(difluoromethylsulfonyl)phenyl]prop-2-enamide (PubChem CID 47093671) has the molecular formula C14H10BrF2NO4S and a molecular weight of 406.20 g/mol. Its IUPAC name is 3-(5-bromofuran-2-yl)-N-[4-(difluoromethylsulfonyl)phenyl]prop-2-enamide.
| Compound Name | 3-(5-bromofuran-2-yl)-N-[4-(difluoromethylsulfonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 47093671 |
| Molecular Formula | C14H10BrF2NO4S |
| Molecular Weight | 406.20 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | 3-(5-bromofuran-2-yl)-N-[4-(difluoromethylsulfonyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Br)o1)Nc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C14H10BrF2NO4S/c15-12-7-3-10(22-12)4-8-13(19)18-9-1-5-11(6-2-9)23(20,21)14(16)17/h1-8,14H,(H,18,19) |
| InChIKey | LSXOLHOECQNXBU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|