C18H20BrN3O5S — CID 2104502
(E)-3-(5-bromofuran-2-yl)-N-[4-(butylcarbamoylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 2104502) has the molecular formula C18H20BrN3O5S and a molecular weight of 470.35 g/mol. Its IUPAC name is (E)-3-(5-bromofuran-2-yl)-N-[4-(butylcarbamoylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromofuran-2-yl)-N-[4-(butylcarbamoylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 2104502 |
| Molecular Formula | C18H20BrN3O5S |
| Molecular Weight | 470.35 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | (E)-3-(5-bromofuran-2-yl)-N-[4-(butylcarbamoylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccc(NC(=O)/C=C/c2ccc(Br)o2)cc1 |
| InChI | InChI=1S/C18H20BrN3O5S/c1-2-3-12-20-18(24)22-28(25,26)15-8-4-13(5-9-15)21-17(23)11-7-14-6-10-16(19)27-14/h4-11H,2-3,12H2,1H3,(H,21,23)(H2,20,22,24)/b11-7+ |
| InChIKey | LDUQPJXNVRUEPI-YRNVUSSQSA-N |
| XLogP | 3.48 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|